Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Copper(I) cyanide, 99%, extra pure
CAS: 544-92-3 Molecular Formula: CCuN Molecular Weight (g/mol): 89.56 MDL Number: MFCD00010975 InChI Key: DOBRDRYODQBAMW-UHFFFAOYSA-N Synonym: copper i cyanide,cupricin,copper +1 cyanide,copper cyanide cu cn,cyanocopper,rcra waste number p029,cucn,rcra waste no. p029,cyano copper PubChem CID: 11009 IUPAC Name: copper(1+);cyanide SMILES: [C-]#N.[Cu+]
| PubChem CID | 11009 |
|---|---|
| CAS | 544-92-3 |
| Molecular Weight (g/mol) | 89.56 |
| MDL Number | MFCD00010975 |
| SMILES | [C-]#N.[Cu+] |
| Synonym | copper i cyanide,cupricin,copper +1 cyanide,copper cyanide cu cn,cyanocopper,rcra waste number p029,cucn,rcra waste no. p029,cyano copper |
| IUPAC Name | copper(1+);cyanide |
| InChI Key | DOBRDRYODQBAMW-UHFFFAOYSA-N |
| Molecular Formula | CCuN |
Hafnium(IV) oxide, 99.95%, (metals basis excluding Zr), Zr typically <0.5%, Thermo Scientific Chemicals
CAS: 12055-23-1 Molecular Formula: HfO2 Molecular Weight (g/mol): 210.49 MDL Number: MFCD00003565 InChI Key: WIHZLLGSGQNAGK-UHFFFAOYSA-N IUPAC Name: hafnium(4+) dioxidandiide SMILES: [O--].[O--].[Hf+4]
| CAS | 12055-23-1 |
|---|---|
| Molecular Weight (g/mol) | 210.49 |
| MDL Number | MFCD00003565 |
| SMILES | [O--].[O--].[Hf+4] |
| IUPAC Name | hafnium(4+) dioxidandiide |
| InChI Key | WIHZLLGSGQNAGK-UHFFFAOYSA-N |
| Molecular Formula | HfO2 |
Cobalt(II) phosphate, anhydrous, 98%
CAS: 13455-36-2 Molecular Formula: Co3O8P2 Molecular Weight (g/mol): 366.739 MDL Number: MFCD00016028 InChI Key: ZBDSFTZNNQNSQM-UHFFFAOYSA-H Synonym: cobalt phosphate,cobaltous phosphate,cobalt ii phosphate,tricobalt bis orthophosphate,unii-0b5m38t47h,cobalt ii phosphate, anhydrous,phosphoric acid, cobalt 2+ salt 2:3,3co.2po4,cobalt ii phosphate octahydrate,phosphoric acid,cobalt 2+ salt 2:3 PubChem CID: 61615 IUPAC Name: cobalt(2+);diphosphate SMILES: [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Co+2].[Co+2].[Co+2]
| PubChem CID | 61615 |
|---|---|
| CAS | 13455-36-2 |
| Molecular Weight (g/mol) | 366.739 |
| MDL Number | MFCD00016028 |
| SMILES | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Co+2].[Co+2].[Co+2] |
| Synonym | cobalt phosphate,cobaltous phosphate,cobalt ii phosphate,tricobalt bis orthophosphate,unii-0b5m38t47h,cobalt ii phosphate, anhydrous,phosphoric acid, cobalt 2+ salt 2:3,3co.2po4,cobalt ii phosphate octahydrate,phosphoric acid,cobalt 2+ salt 2:3 |
| IUPAC Name | cobalt(2+);diphosphate |
| InChI Key | ZBDSFTZNNQNSQM-UHFFFAOYSA-H |
| Molecular Formula | Co3O8P2 |
Copper discs, 9.0^+0.127mm (0.354^+0.005in) dia x 0.8^+0.051mm (0.03^+0.002in) thick, 99.9995% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Hydrazine dihydrochloride, 99%
CAS: 5341-61-7 Molecular Formula: ClH5N2 Molecular Weight (g/mol): 68.50 MDL Number: MFCD00064543 InChI Key: BIVUUOPIAYRCAP-UHFFFAOYSA-N Synonym: hydrazine dihydrochloride,hydrazine, dihydrochloride,unii-km8dd9j0c8,ccris 5479,diamine dihydrochloride,hydrazinium monochloride,km8dd9j0c8,hydrazine, hydrochloride 1:2,hydrazinedihydrochloride,hydrazine hcl PubChem CID: 17548 IUPAC Name: hydrazine;dihydrochloride SMILES: [H+].[Cl-].NN
| PubChem CID | 17548 |
|---|---|
| CAS | 5341-61-7 |
| Molecular Weight (g/mol) | 68.50 |
| MDL Number | MFCD00064543 |
| SMILES | [H+].[Cl-].NN |
| Synonym | hydrazine dihydrochloride,hydrazine, dihydrochloride,unii-km8dd9j0c8,ccris 5479,diamine dihydrochloride,hydrazinium monochloride,km8dd9j0c8,hydrazine, hydrochloride 1:2,hydrazinedihydrochloride,hydrazine hcl |
| IUPAC Name | hydrazine;dihydrochloride |
| InChI Key | BIVUUOPIAYRCAP-UHFFFAOYSA-N |
| Molecular Formula | ClH5N2 |
Ferric Subsulfate, Powder, Purified, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 1310-45-8
| CAS | 1310-45-8 |
|---|
Dihydrogen hexachloroplatinate(IV) hydrate, 99.9% (metals basis)
CAS: 26023-84-7 Molecular Formula: Cl6H2Pt Molecular Weight (g/mol): 409.80 MDL Number: MFCD00149909 InChI Key: ZKOQTCCVSRSECD-UHFFFAOYSA-J Synonym: CPA,Chloroplatinic acid IUPAC Name: dihydrogen hexachloroplatinumtetrakis(ylium) SMILES: [H+].[H+].Cl[Pt+4](Cl)(Cl)(Cl)(Cl)Cl
| CAS | 26023-84-7 |
|---|---|
| Molecular Weight (g/mol) | 409.80 |
| MDL Number | MFCD00149909 |
| SMILES | [H+].[H+].Cl[Pt+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | CPA,Chloroplatinic acid |
| IUPAC Name | dihydrogen hexachloroplatinumtetrakis(ylium) |
| InChI Key | ZKOQTCCVSRSECD-UHFFFAOYSA-J |
| Molecular Formula | Cl6H2Pt |
Ruthenium(III) chloride oxide, ammoniated
CAS: 11103-72-3 Molecular Formula: Cl6H46N14O2Ru3 Molecular Weight (g/mol): 790.374 MDL Number: MFCD00011479 InChI Key: JQJSTVUROJELSR-UHFFFAOYSA-H Synonym: 6cl.o2ru3.14nh3,ruthenium red, technical grade,degrees +/->> aeno>> ie,azane;ruthenium 2+ ;hexachloride;dihydrate,ruthenium red, for microscopy calc. on dry substance, at,ruthenium red, for microscopy calc. on dry basis, at,triruthenoxane-1,1,3,3,5,5-hexakis ylium tetradecaamine hexachloride PubChem CID: 16218584 IUPAC Name: azane;ruthenium(2+);hexachloride;dihydrate SMILES: N.N.N.N.N.N.N.N.N.N.N.N.N.N.O.O.[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ru+2].[Ru+2].[Ru+2]
| PubChem CID | 16218584 |
|---|---|
| CAS | 11103-72-3 |
| Molecular Weight (g/mol) | 790.374 |
| MDL Number | MFCD00011479 |
| SMILES | N.N.N.N.N.N.N.N.N.N.N.N.N.N.O.O.[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ru+2].[Ru+2].[Ru+2] |
| Synonym | 6cl.o2ru3.14nh3,ruthenium red, technical grade,degrees +/->> aeno>> ie,azane;ruthenium 2+ ;hexachloride;dihydrate,ruthenium red, for microscopy calc. on dry substance, at,ruthenium red, for microscopy calc. on dry basis, at,triruthenoxane-1,1,3,3,5,5-hexakis ylium tetradecaamine hexachloride |
| IUPAC Name | azane;ruthenium(2+);hexachloride;dihydrate |
| InChI Key | JQJSTVUROJELSR-UHFFFAOYSA-H |
| Molecular Formula | Cl6H46N14O2Ru3 |
Cobalt(II,III) oxide, 99.7% (metals basis)
CAS: 1308-06-1 Molecular Formula: Co3O4 Molecular Weight (g/mol): 240.80 MDL Number: MFCD00010939 InChI Key: UBEWDCMIDFGDOO-UHFFFAOYSA-N Synonym: oxocobalt; oxo oxocobaltiooxy cobalt,cobalt ii oxide; cobalt iii oxide,cobalt ii,coo.co2o3,aronis24129,cobaltic tetraoxide,,cobalt ii,iii oxide, powder, <10 mum,cobalt ii oxide; oxo oxocobaltio oxy cobalt,cobalt ii,iii oxide metals basis , 2-6 micron powder,oxidanylidenecobalt; oxidanylidene oxidanylidenecobaltiooxy cobalt PubChem CID: 11651651 SMILES: [O--].[O--].[O--].[O--].[Co++].[Co+3].[Co+3]
| PubChem CID | 11651651 |
|---|---|
| CAS | 1308-06-1 |
| Molecular Weight (g/mol) | 240.80 |
| MDL Number | MFCD00010939 |
| SMILES | [O--].[O--].[O--].[O--].[Co++].[Co+3].[Co+3] |
| Synonym | oxocobalt; oxo oxocobaltiooxy cobalt,cobalt ii oxide; cobalt iii oxide,cobalt ii,coo.co2o3,aronis24129,cobaltic tetraoxide,,cobalt ii,iii oxide, powder, <10 mum,cobalt ii oxide; oxo oxocobaltio oxy cobalt,cobalt ii,iii oxide metals basis , 2-6 micron powder,oxidanylidenecobalt; oxidanylidene oxidanylidenecobaltiooxy cobalt |
| InChI Key | UBEWDCMIDFGDOO-UHFFFAOYSA-N |
| Molecular Formula | Co3O4 |
Scandium(III) perchlorate, 50% w/w aq. soln., Reagent Grade, Thermo Scientific™
CAS: 14066-05-8 Molecular Formula: Cl3O12Sc Molecular Weight (g/mol): 343.294 MDL Number: MFCD00243289 InChI Key: UBVKRMCXDCYZQK-UHFFFAOYSA-K Synonym: scandium perchlorate,scandium 3+ perchlorate,acmc-20ajr3,scandium 3+ ion triperchlorate,trihyperchloric acid scandium salt,scandium iii perchlorate solution,scandium 3+ triperchlorate PubChem CID: 11013318 IUPAC Name: scandium(3+);triperchlorate SMILES: [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Sc+3]
| PubChem CID | 11013318 |
|---|---|
| CAS | 14066-05-8 |
| Molecular Weight (g/mol) | 343.294 |
| MDL Number | MFCD00243289 |
| SMILES | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Sc+3] |
| Synonym | scandium perchlorate,scandium 3+ perchlorate,acmc-20ajr3,scandium 3+ ion triperchlorate,trihyperchloric acid scandium salt,scandium iii perchlorate solution,scandium 3+ triperchlorate |
| IUPAC Name | scandium(3+);triperchlorate |
| InChI Key | UBVKRMCXDCYZQK-UHFFFAOYSA-K |
| Molecular Formula | Cl3O12Sc |
Cobalt(II,III) oxide
CAS: 1308-06-1 Molecular Formula: Co3O4 Molecular Weight (g/mol): 240.80 MDL Number: MFCD00010939 InChI Key: UBEWDCMIDFGDOO-UHFFFAOYSA-N Synonym: oxocobalt; oxo oxocobaltiooxy cobalt,cobalt ii oxide; cobalt iii oxide,cobalt ii,coo.co2o3,aronis24129,cobaltic tetraoxide,,cobalt ii,iii oxide, powder, <10 mum,cobalt ii oxide; oxo oxocobaltio oxy cobalt,cobalt ii,iii oxide metals basis , 2-6 micron powder,oxidanylidenecobalt; oxidanylidene oxidanylidenecobaltiooxy cobalt PubChem CID: 11651651 IUPAC Name: oxocobalt;oxo(oxocobaltiooxy)cobalt SMILES: [O--].[O--].[O--].[O--].[Co++].[Co+3].[Co+3]
| PubChem CID | 11651651 |
|---|---|
| CAS | 1308-06-1 |
| Molecular Weight (g/mol) | 240.80 |
| MDL Number | MFCD00010939 |
| SMILES | [O--].[O--].[O--].[O--].[Co++].[Co+3].[Co+3] |
| Synonym | oxocobalt; oxo oxocobaltiooxy cobalt,cobalt ii oxide; cobalt iii oxide,cobalt ii,coo.co2o3,aronis24129,cobaltic tetraoxide,,cobalt ii,iii oxide, powder, <10 mum,cobalt ii oxide; oxo oxocobaltio oxy cobalt,cobalt ii,iii oxide metals basis , 2-6 micron powder,oxidanylidenecobalt; oxidanylidene oxidanylidenecobaltiooxy cobalt |
| IUPAC Name | oxocobalt;oxo(oxocobaltiooxy)cobalt |
| InChI Key | UBEWDCMIDFGDOO-UHFFFAOYSA-N |
| Molecular Formula | Co3O4 |
Iron(II) oxalate dihydrate, 99%
CAS: 6047-25-2 Molecular Formula: C2H4FeO6 Molecular Weight (g/mol): 179.89 MDL Number: MFCD00150040 MFCD00012475 InChI Key: NPLZZSLZTJVZSX-UHFFFAOYSA-L Synonym: ferrous oxalate dihydrate,unii-z6x3ybu50d,z6x3ybu50d,iron ii oxalate hydrate,iron ii oxalate dihydrate,iron oxalate dihydrate,iron 2+ ; oxalate; dihydrate,iron, diaqua ethanedioato 2--kappao1,kappao2-, t-4,iron ii oxalate dihydrate 250g,iron ii oxalate dihydrate, puratronic™ PubChem CID: 516788 IUPAC Name: iron(2+);oxalate;dihydrate SMILES: O.O.[Fe++].[O-]C(=O)C([O-])=O
| PubChem CID | 516788 |
|---|---|
| CAS | 6047-25-2 |
| Molecular Weight (g/mol) | 179.89 |
| MDL Number | MFCD00150040 MFCD00012475 |
| SMILES | O.O.[Fe++].[O-]C(=O)C([O-])=O |
| Synonym | ferrous oxalate dihydrate,unii-z6x3ybu50d,z6x3ybu50d,iron ii oxalate hydrate,iron ii oxalate dihydrate,iron oxalate dihydrate,iron 2+ ; oxalate; dihydrate,iron, diaqua ethanedioato 2--kappao1,kappao2-, t-4,iron ii oxalate dihydrate 250g,iron ii oxalate dihydrate, puratronic™ |
| IUPAC Name | iron(2+);oxalate;dihydrate |
| InChI Key | NPLZZSLZTJVZSX-UHFFFAOYSA-L |
| Molecular Formula | C2H4FeO6 |
Silver sulfate, Premion™, 99.99% (metals basis), Ag 68.9% min
CAS: 10294-26-5 Molecular Formula: Ag2H2O4S Molecular Weight (g/mol): 313.81 MDL Number: MFCD00003407 InChI Key: YPNVIBVEFVRZPJ-UHFFFAOYSA-N Synonym: silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt PubChem CID: 159865 IUPAC Name: disilver(1+) sulfuric acid SMILES: [Ag+].[Ag+].OS(O)(=O)=O
| PubChem CID | 159865 |
|---|---|
| CAS | 10294-26-5 |
| Molecular Weight (g/mol) | 313.81 |
| MDL Number | MFCD00003407 |
| SMILES | [Ag+].[Ag+].OS(O)(=O)=O |
| Synonym | silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt |
| IUPAC Name | disilver(1+) sulfuric acid |
| InChI Key | YPNVIBVEFVRZPJ-UHFFFAOYSA-N |
| Molecular Formula | Ag2H2O4S |
Molybdenum(IV) sulfide, 98.5%
CAS: 1317-33-5 Molecular Formula: MoS2 Molecular Weight (g/mol): 160.07 InChI Key: CWQXQMHSOZUFJS-UHFFFAOYSA-N Synonym: molybdenum disulfide,molybdenite,molybdenum iv sulfide,molybdenum disulphide,molysulfide,molykote,motimol,nichimoly c,sumipowder pa,molykote z PubChem CID: 14823 ChEBI: CHEBI:30704 IUPAC Name: bis(sulfanylidene)molybdenum SMILES: S=[Mo]=S
| PubChem CID | 14823 |
|---|---|
| CAS | 1317-33-5 |
| Molecular Weight (g/mol) | 160.07 |
| ChEBI | CHEBI:30704 |
| SMILES | S=[Mo]=S |
| Synonym | molybdenum disulfide,molybdenite,molybdenum iv sulfide,molybdenum disulphide,molysulfide,molykote,motimol,nichimoly c,sumipowder pa,molykote z |
| IUPAC Name | bis(sulfanylidene)molybdenum |
| InChI Key | CWQXQMHSOZUFJS-UHFFFAOYSA-N |
| Molecular Formula | MoS2 |
Tetraammineplatinum(II) chloride monohydrate, Premion™, 99.995% (metals basis)
CAS: 13933-33-0 Molecular Formula: Cl2H14N4OPt Molecular Weight (g/mol): 352.12 MDL Number: MFCD00149947 InChI Key: GWBDNMCYHWRSOH-UHFFFAOYSA-L Synonym: azane;platinum 2+ ;dichloride;hydrate,tetrammineplatinum ii chloride hydrate,tetraammineplatinum ii chloride monohydrate,platinum 2+ ion tetraamine hydrate dichloride,platinum 2+ tetraamine hydrate dichloride,platinum 2+ chloride-ammonia-water 1/2/4/1,tetraamineplatinium ii chloride PubChem CID: 21946612 IUPAC Name: azane;platinum(2+);dichloride;hydrate SMILES: N.N.N.N.O.[Cl-].[Cl-].[Pt++]
| PubChem CID | 21946612 |
|---|---|
| CAS | 13933-33-0 |
| Molecular Weight (g/mol) | 352.12 |
| MDL Number | MFCD00149947 |
| SMILES | N.N.N.N.O.[Cl-].[Cl-].[Pt++] |
| Synonym | azane;platinum 2+ ;dichloride;hydrate,tetrammineplatinum ii chloride hydrate,tetraammineplatinum ii chloride monohydrate,platinum 2+ ion tetraamine hydrate dichloride,platinum 2+ tetraamine hydrate dichloride,platinum 2+ chloride-ammonia-water 1/2/4/1,tetraamineplatinium ii chloride |
| IUPAC Name | azane;platinum(2+);dichloride;hydrate |
| InChI Key | GWBDNMCYHWRSOH-UHFFFAOYSA-L |
| Molecular Formula | Cl2H14N4OPt |